C56H30N8 — CID 155761318
9-[2-[2-(3,6-diisocyanocarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile (PubChem CID 155761318) has the molecular formula C56H30N8 and a molecular weight of 814.91 g/mol. Its IUPAC name is 9-[2-[2-(3,6-diisocyanocarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile.
| Compound Name | 9-[2-[2-(3,6-diisocyanocarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155761318 |
| Molecular Formula | C56H30N8 |
| Molecular Weight | 814.91 g/mol |
| Exact Mass | 814.26 |
| IUPAC Name | 9-[2-[2-(3,6-diisocyanocarbazol-9-yl)-6-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(C#N)ccc1n2-c1ccccc1-c1c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cccc1-n1c2ccc([N+]#[C-])cc2c2cc([N+]#[C-])ccc21 |
| InChI | InChI=1S/C56H30N8/c1-58-38-22-26-51-44(30-38)43-29-35(34-57)21-25-50(43)63(51)49-19-11-10-17-41(49)55-42(56-61-47(36-13-6-4-7-14-36)33-48(62-56)37-15-8-5-9-16-37)18-12-20-54(55)64-52-27-23-39(59-2)31-45(52)46-32-40(60-3)24-28-53(46)64/h4-33H |
| InChIKey | JMKXIXRABOUJRZ-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 72.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.91 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|