C54H33N7 — CID 159808998
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-(3-isocyanocarbazol-9-yl)-6-methylphenyl]phenyl]carbazole-3-carbonitrile (PubChem CID 159808998) has the molecular formula C54H33N7 and a molecular weight of 779.91 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-(3-isocyanocarbazol-9-yl)-6-methylphenyl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-(3-isocyanocarbazol-9-yl)-6-methylphenyl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 159808998 |
| Molecular Formula | C54H33N7 |
| Molecular Weight | 779.91 g/mol |
| Exact Mass | 779.28 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[2-(3-isocyanocarbazol-9-yl)-6-methylphenyl]phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1cccc(C)c1-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-n1c2ccccc2c2cc(C#N)ccc21 |
| InChI | InChI=1S/C54H33N7/c1-34-14-13-23-50(61-46-22-12-10-20-41(46)43-32-39(56-2)26-29-48(43)61)51(34)44-31-38(54-58-52(36-15-5-3-6-16-36)57-53(59-54)37-17-7-4-8-18-37)25-28-49(44)60-45-21-11-9-19-40(45)42-30-35(33-55)24-27-47(42)60/h3-32H,1H3 |
| InChIKey | MKKMSCMMATZLFK-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.91 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|