C15H34N2O — CID 166970241
2-methyl-6-N-[(2-methylpropan-2-yl)oxy]-2-N-propan-2-ylheptane-2,6-diamine (PubChem CID 166970241) has the molecular formula C15H34N2O and a molecular weight of 258.45 g/mol. Its IUPAC name is 2-methyl-6-N-[(2-methylpropan-2-yl)oxy]-2-N-propan-2-ylheptane-2,6-diamine.
| Compound Name | 2-methyl-6-N-[(2-methylpropan-2-yl)oxy]-2-N-propan-2-ylheptane-2,6-diamine |
|---|---|
| PubChem CID | 166970241 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | 2-methyl-6-N-[(2-methylpropan-2-yl)oxy]-2-N-propan-2-ylheptane-2,6-diamine |
| SMILES | CC(C)NC(C)(C)CCCC(C)NOC(C)(C)C |
| InChI | InChI=1S/C15H34N2O/c1-12(2)16-15(7,8)11-9-10-13(3)17-18-14(4,5)6/h12-13,16-17H,9-11H2,1-8H3 |
| InChIKey | NWPLMUAGUVBJFK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|