C25H27F4N3O2 — CID 166970271
3-[2-[(1R,2S,5R,7S)-7-amino-2-methyl-9-azabicyclo[3.3.1]nonan-9-yl]-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide (PubChem CID 166970271) has the molecular formula C25H27F4N3O2 and a molecular weight of 477.50 g/mol. Its IUPAC name is 3-[2-[(1R,2S,5R,7S)-7-amino-2-methyl-9-azabicyclo[3.3.1]nonan-9-yl]-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide.
| Compound Name | 3-[2-[(1R,2S,5R,7S)-7-amino-2-methyl-9-azabicyclo[3.3.1]nonan-9-yl]-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 166970271 |
| Molecular Formula | C25H27F4N3O2 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-[2-[(1R,2S,5R,7S)-7-amino-2-methyl-9-azabicyclo[3.3.1]nonan-9-yl]-1,1-difluoro-2-oxoethyl]-4-fluoro-N-(4-fluoro-3-methylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)c(C(F)(F)C(=O)N3[C@@H]4CC[C@H](C)[C@H]3C[C@@H](N)C4)c2)ccc1F |
| InChI | InChI=1S/C25H27F4N3O2/c1-13-3-6-18-11-16(30)12-22(13)32(18)24(34)25(28,29)19-10-15(4-7-21(19)27)23(33)31-17-5-8-20(26)14(2)9-17/h4-5,7-10,13,16,18,22H,3,6,11-12,30H2,1-2H3,(H,31,33)/t13-,16-,18+,22+/m0/s1 |
| InChIKey | FAUZOCLTUYMFOQ-GMWHKMPYSA-N |
| XLogP | 4.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |