C29H25N3O — CID 166972586
3-(1-ethenyl-3-prop-2-enyl-3,4-dihydroisoquinolin-4-yl)-5,13-dimethyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene (PubChem CID 166972586) has the molecular formula C29H25N3O and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-(1-ethenyl-3-prop-2-enyl-3,4-dihydroisoquinolin-4-yl)-5,13-dimethyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene.
| Compound Name | 3-(1-ethenyl-3-prop-2-enyl-3,4-dihydroisoquinolin-4-yl)-5,13-dimethyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 166972586 |
| Molecular Formula | C29H25N3O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-(1-ethenyl-3-prop-2-enyl-3,4-dihydroisoquinolin-4-yl)-5,13-dimethyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene |
| SMILES | C=CCC1N=C(C=C)c2ccccc2C1C1N=C(C)c2ccc3c(oc4nc(C)ccc43)c21 |
| InChI | InChI=1S/C29H25N3O/c1-5-9-24-25(20-11-8-7-10-19(20)23(6-2)32-24)27-26-18(17(4)31-27)14-15-21-22-13-12-16(3)30-29(22)33-28(21)26/h5-8,10-15,24-25,27H,1-2,9H2,3-4H3 |
| InChIKey | HSFZIXFATIQIDX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|