C52H35N3O — CID 166974624
1-(2,6-diphenylpyrimidin-4-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-3-amine (PubChem CID 166974624) has the molecular formula C52H35N3O and a molecular weight of 717.87 g/mol. Its IUPAC name is 1-(2,6-diphenylpyrimidin-4-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-3-amine.
| Compound Name | 1-(2,6-diphenylpyrimidin-4-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 166974624 |
| Molecular Formula | C52H35N3O |
| Molecular Weight | 717.87 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | 1-(2,6-diphenylpyrimidin-4-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-3-amine |
| SMILES | c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c4c(c3)oc3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C52H35N3O/c1-5-15-36(16-6-1)38-25-29-42(30-26-38)55(43-31-27-39(28-32-43)37-17-7-2-8-18-37)44-33-46(51-45-23-13-14-24-49(45)56-50(51)34-44)48-35-47(40-19-9-3-10-20-40)53-52(54-48)41-21-11-4-12-22-41/h1-35H |
| InChIKey | NMVKKZNYSGAGBK-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.87 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |