C11H15FN2O4 — CID 166975288
(2R,3R,4R,5S)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 166975288) has the molecular formula C11H15FN2O4 and a molecular weight of 258.25 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 166975288 |
| Molecular Formula | C11H15FN2O4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2R,3R,4R,5S)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1OC[C@H](Nc2cccc(F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15FN2O4/c12-8-2-1-3-9(14-8)13-6-5-18-7(4-15)11(17)10(6)16/h1-3,6-7,10-11,15-17H,4-5H2,(H,13,14)/t6-,7+,10+,11-/m0/s1 |
| InChIKey | PGHCETGCGRHAFW-HJGGDWJDSA-N |
| XLogP | -0.89 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|