C52H37N3O — CID 166975321
4-(4-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-2-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine (PubChem CID 166975321) has the molecular formula C52H37N3O and a molecular weight of 719.89 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-2-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine.
| Compound Name | 4-(4-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-2-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 166975321 |
| Molecular Formula | C52H37N3O |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.29 |
| IUPAC Name | 4-(4-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-2-yl)-N,N-bis(4-phenylphenyl)dibenzofuran-1-amine |
| SMILES | C1=CCCC(c2cc(-c3ccccc3)nc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)c4c3oc3ccccc34)n2)=C1 |
| InChI | InChI=1S/C52H37N3O/c1-5-15-36(16-6-1)38-25-29-42(30-26-38)55(43-31-27-39(28-32-43)37-17-7-2-8-18-37)48-34-33-45(51-50(48)44-23-13-14-24-49(44)56-51)52-53-46(40-19-9-3-10-20-40)35-47(54-52)41-21-11-4-12-22-41/h1-11,13-21,23-35H,12,22H2 |
| InChIKey | SSHHYSJRRFEPSN-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |