C22H21FN6S — CID 166976359
4-[[[5-fluoro-6-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]pyrimidin-4-yl]amino]methyl]benzenethiol (PubChem CID 166976359) has the molecular formula C22H21FN6S and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-[[[5-fluoro-6-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]pyrimidin-4-yl]amino]methyl]benzenethiol.
| Compound Name | 4-[[[5-fluoro-6-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]pyrimidin-4-yl]amino]methyl]benzenethiol |
|---|---|
| PubChem CID | 166976359 |
| Molecular Formula | C22H21FN6S |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[[[5-fluoro-6-[methyl-[(4-pyrazol-1-ylphenyl)methyl]amino]pyrimidin-4-yl]amino]methyl]benzenethiol |
| SMILES | CN(Cc1ccc(-n2cccn2)cc1)c1ncnc(NCc2ccc(S)cc2)c1F |
| InChI | InChI=1S/C22H21FN6S/c1-28(14-17-3-7-18(8-4-17)29-12-2-11-27-29)22-20(23)21(25-15-26-22)24-13-16-5-9-19(30)10-6-16/h2-12,15,30H,13-14H2,1H3,(H,24,25,26) |
| InChIKey | UUZRATNNVYGOHX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|