C12H16N2O2S — CID 166978169
1-(4-propan-2-ylphenyl)sulfonyl-4,5-dihydroimidazole (PubChem CID 166978169) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)sulfonyl-4,5-dihydroimidazole.
| Compound Name | 1-(4-propan-2-ylphenyl)sulfonyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 166978169 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)sulfonyl-4,5-dihydroimidazole |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2C=NCC2)cc1 |
| InChI | InChI=1S/C12H16N2O2S/c1-10(2)11-3-5-12(6-4-11)17(15,16)14-8-7-13-9-14/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | GBBWYZSESPTAIU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |