C27H36N6O2 — CID 166981598
2-[4-[2-(dimethylamino)ethoxy]-3-methylanilino]-7-[(2R,4R)-2,4-dimethyl-1-bicyclo[1.1.1]pentanyl]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 166981598) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethoxy]-3-methylanilino]-7-[(2R,4R)-2,4-dimethyl-1-bicyclo[1.1.1]pentanyl]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-[4-[2-(dimethylamino)ethoxy]-3-methylanilino]-7-[(2R,4R)-2,4-dimethyl-1-bicyclo[1.1.1]pentanyl]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 166981598 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethoxy]-3-methylanilino]-7-[(2R,4R)-2,4-dimethyl-1-bicyclo[1.1.1]pentanyl]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cc(Nc2ncc3cc(C(=O)N(C)C)n(C45CC([C@H]4C)[C@H]5C)c3n2)ccc1OCCN(C)C |
| InChI | InChI=1S/C27H36N6O2/c1-16-12-20(8-9-23(16)35-11-10-31(4)5)29-26-28-15-19-13-22(25(34)32(6)7)33(24(19)30-26)27-14-21(17(27)2)18(27)3/h8-9,12-13,15,17-18,21H,10-11,14H2,1-7H3,(H,28,29,30)/t17-,18-,21?,27?/m1/s1 |
| InChIKey | DSIZAXITPAFTDK-DYWKYMEGSA-N |
| XLogP | 4.13 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |