C8H12N2O2 — CID 166982026
(1E)-3,4-dinitrosocyclooctene (PubChem CID 166982026) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is (1E)-3,4-dinitrosocyclooctene.
| Compound Name | (1E)-3,4-dinitrosocyclooctene |
|---|---|
| PubChem CID | 166982026 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (1E)-3,4-dinitrosocyclooctene |
| SMILES | O=NC1/C=C\CCCCC1N=O |
| InChI | InChI=1S/C8H12N2O2/c11-9-7-5-3-1-2-4-6-8(7)10-12/h3,5,7-8H,1-2,4,6H2/b5-3- |
| InChIKey | FVPVOFHTVOYROZ-HYXAFXHYSA-N |
| XLogP | 2.39 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|