C18H24O4 — CID 166983502
methyl (1S,4aR,10aS)-6,10a-dihydroxy-1,4a-dimethyl-3,4,9,10-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 166983502) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl (1S,4aR,10aS)-6,10a-dihydroxy-1,4a-dimethyl-3,4,9,10-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aR,10aS)-6,10a-dihydroxy-1,4a-dimethyl-3,4,9,10-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 166983502 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl (1S,4aR,10aS)-6,10a-dihydroxy-1,4a-dimethyl-3,4,9,10-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(O)ccc3CC[C@@]12O |
| InChI | InChI=1S/C18H24O4/c1-16-8-4-9-17(2,15(20)22-3)18(16,21)10-7-12-5-6-13(19)11-14(12)16/h5-6,11,19,21H,4,7-10H2,1-3H3/t16-,17-,18+/m1/s1 |
| InChIKey | CWLWETSJLPUUGX-KURKYZTESA-N |
| XLogP | 2.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |