About 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine
6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine (PubChem CID 166984319) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine.
Analyze 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine?
The IUPAC name of 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine (CID 166984319) is 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine.
What is the SMILES notation for 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine?
The canonical SMILES for 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine is CC12C=C(F)CN1CCC2.
What is the InChIKey of 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine?
The InChIKey is YZAHCZZPASGJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN/c1-8-3-2-4-10(8)6-7(9)5-8/h5H,2-4,6H2,1H3.
What are the key properties of 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine?
6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine has a molecular weight of 141.19 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8-methyl-1,2,3,5-tetrahydropyrrolizine is sourced from PubChem (CID 166984319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).