C9H14FN — CID 166984255
8-ethyl-7-fluoro-1,2,3,5-tetrahydropyrrolizine (PubChem CID 166984255) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 8-ethyl-7-fluoro-1,2,3,5-tetrahydropyrrolizine.
| Compound Name | 8-ethyl-7-fluoro-1,2,3,5-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 166984255 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 8-ethyl-7-fluoro-1,2,3,5-tetrahydropyrrolizine |
| SMILES | CCC12CCCN1CC=C2F |
| InChI | InChI=1S/C9H14FN/c1-2-9-5-3-6-11(9)7-4-8(9)10/h4H,2-3,5-7H2,1H3 |
| InChIKey | GAOBPLWHNXWJJQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |