C28H33ClF3N7O2 — CID 166986036
(6R)-7-[4-chloro-3-(trifluoromethyl)benzoyl]-6-methyl-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]-2-(propan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 166986036) has the molecular formula C28H33ClF3N7O2 and a molecular weight of 592.07 g/mol. Its IUPAC name is (6R)-7-[4-chloro-3-(trifluoromethyl)benzoyl]-6-methyl-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]-2-(propan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | (6R)-7-[4-chloro-3-(trifluoromethyl)benzoyl]-6-methyl-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]-2-(propan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166986036 |
| Molecular Formula | C28H33ClF3N7O2 |
| Molecular Weight | 592.07 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | (6R)-7-[4-chloro-3-(trifluoromethyl)benzoyl]-6-methyl-3-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]-2-(propan-2-ylamino)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc(C2CCC(n3c(NC(C)C)nc4c(c3=O)C[C@@H](C)N(C(=O)c3ccc(Cl)c(C(F)(F)F)c3)C4)CC2)n[nH]1 |
| InChI | InChI=1S/C28H33ClF3N7O2/c1-14(2)33-27-35-23-13-38(25(40)18-7-10-22(29)21(12-18)28(30,31)32)15(3)11-20(23)26(41)39(27)19-8-5-17(6-9-19)24-34-16(4)36-37-24/h7,10,12,14-15,17,19H,5-6,8-9,11,13H2,1-4H3,(H,33,35)(H,34,36,37)/t15-,17?,19?/m1/s1 |
| InChIKey | KPRSBBXNIMJZQZ-LSJNQWAISA-N |
| XLogP | 5.65 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.07 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |