C36H69NO7S — CID 166986111
4-[(6,10,14,15,21-pentahydroxy-3,3,17,17,19,19-hexamethylhexacosyl)amino]-2-sulfanyl-2H-furan-5-one (PubChem CID 166986111) has the molecular formula C36H69NO7S and a molecular weight of 660.02 g/mol. Its IUPAC name is 4-[(6,10,14,15,21-pentahydroxy-3,3,17,17,19,19-hexamethylhexacosyl)amino]-2-sulfanyl-2H-furan-5-one.
| Compound Name | 4-[(6,10,14,15,21-pentahydroxy-3,3,17,17,19,19-hexamethylhexacosyl)amino]-2-sulfanyl-2H-furan-5-one |
|---|---|
| PubChem CID | 166986111 |
| Molecular Formula | C36H69NO7S |
| Molecular Weight | 660.02 g/mol |
| Exact Mass | 659.48 |
| IUPAC Name | 4-[(6,10,14,15,21-pentahydroxy-3,3,17,17,19,19-hexamethylhexacosyl)amino]-2-sulfanyl-2H-furan-5-one |
| SMILES | CCCCCC(O)CC(C)(C)CC(C)(C)CC(O)C(O)CCCC(O)CCCC(O)CCC(C)(C)CCNC1=CC(S)OC1=O |
| InChI | InChI=1S/C36H69NO7S/c1-8-9-10-13-28(40)23-35(4,5)25-36(6,7)24-31(42)30(41)17-12-16-26(38)14-11-15-27(39)18-19-34(2,3)20-21-37-29-22-32(45)44-33(29)43/h22,26-28,30-32,37-42,45H,8-21,23-25H2,1-7H3 |
| InChIKey | NMHVFLAVZMYKSZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.02 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|