C15H22N4O4S — CID 166986654
(2,5-dioxopyrrolidin-1-yl) 5-[(3aS,4S,6aR)-2-methylimino-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 166986654) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[(3aS,4S,6aR)-2-methylimino-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[(3aS,4S,6aR)-2-methylimino-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 166986654 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[(3aS,4S,6aR)-2-methylimino-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | C/N=C1/N[C@H]2[C@H](CS[C@H]2CCCCC(=O)ON2C(=O)CCC2=O)N1 |
| InChI | InChI=1S/C15H22N4O4S/c1-16-15-17-9-8-24-10(14(9)18-15)4-2-3-5-13(22)23-19-11(20)6-7-12(19)21/h9-10,14H,2-8H2,1H3,(H2,16,17,18)/t9-,10-,14-/m0/s1 |
| InChIKey | RLVXLWMHVPBHTK-BHDSKKPTSA-N |
| XLogP | 0.19 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|