C23H34F3N3O2S — CID 166990420
(2R,3S)-N-ethyl-3-(methylsulfanylamino)-2-[[4-[3-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]piperidine-1-carboxamide (PubChem CID 166990420) has the molecular formula C23H34F3N3O2S and a molecular weight of 473.61 g/mol. Its IUPAC name is (2R,3S)-N-ethyl-3-(methylsulfanylamino)-2-[[4-[3-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]piperidine-1-carboxamide.
| Compound Name | (2R,3S)-N-ethyl-3-(methylsulfanylamino)-2-[[4-[3-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166990420 |
| Molecular Formula | C23H34F3N3O2S |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2R,3S)-N-ethyl-3-(methylsulfanylamino)-2-[[4-[3-(trifluoromethyl)phenyl]cyclohexyl]oxymethyl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC[C@H](NSC)[C@@H]1COC1CCC(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H34F3N3O2S/c1-3-27-22(30)29-13-5-8-20(28-32-2)21(29)15-31-19-11-9-16(10-12-19)17-6-4-7-18(14-17)23(24,25)26/h4,6-7,14,16,19-21,28H,3,5,8-13,15H2,1-2H3,(H,27,30)/t16?,19?,20-,21-/m0/s1 |
| InChIKey | ILMOUKXKVFRSPS-APHPEJJXSA-N |
| XLogP | 5.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|