C22H31F3N2O3S — CID 166854314
1-[(2R)-3-(methylsulfanylamino)-2-[[4-[2-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-1-yl]ethanone (PubChem CID 166854314) has the molecular formula C22H31F3N2O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-[(2R)-3-(methylsulfanylamino)-2-[[4-[2-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-3-(methylsulfanylamino)-2-[[4-[2-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166854314 |
| Molecular Formula | C22H31F3N2O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[(2R)-3-(methylsulfanylamino)-2-[[4-[2-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]piperidin-1-yl]ethanone |
| SMILES | CSNC1CCCN(C(C)=O)[C@H]1COC1CCC(c2ccccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C22H31F3N2O3S/c1-15(28)27-13-5-7-19(26-31-2)20(27)14-29-17-11-9-16(10-12-17)18-6-3-4-8-21(18)30-22(23,24)25/h3-4,6,8,16-17,19-20,26H,5,7,9-14H2,1-2H3/t16?,17?,19?,20-/m0/s1 |
| InChIKey | IHBUAUIWXMGFRT-CSPVLLTOSA-N |
| XLogP | 4.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|