C25H40N2O3S — CID 166990169
1-[(2R,3S)-3-(benzylsulfanyloxymethylamino)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-1-yl]ethanone (PubChem CID 166990169) has the molecular formula C25H40N2O3S and a molecular weight of 448.67 g/mol. Its IUPAC name is 1-[(2R,3S)-3-(benzylsulfanyloxymethylamino)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(2R,3S)-3-(benzylsulfanyloxymethylamino)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166990169 |
| Molecular Formula | C25H40N2O3S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1-[(2R,3S)-3-(benzylsulfanyloxymethylamino)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@H](NCOSCc2ccccc2)[C@@H]1COC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C25H40N2O3S/c1-19(2)22-11-13-23(14-12-22)29-16-25-24(10-7-15-27(25)20(3)28)26-18-30-31-17-21-8-5-4-6-9-21/h4-6,8-9,19,22-26H,7,10-18H2,1-3H3/t22?,23?,24-,25-/m0/s1 |
| InChIKey | BAQXCPHGDLPCPL-OVKIHRCZSA-N |
| XLogP | 5.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|