C13H25N — CID 166992287
(E)-N,2,5-trimethyldec-4-en-3-imine (PubChem CID 166992287) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (E)-N,2,5-trimethyldec-4-en-3-imine.
| Compound Name | (E)-N,2,5-trimethyldec-4-en-3-imine |
|---|---|
| PubChem CID | 166992287 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (E)-N,2,5-trimethyldec-4-en-3-imine |
| SMILES | CCCCC/C(C)=C/C(=N/C)C(C)C |
| InChI | InChI=1S/C13H25N/c1-6-7-8-9-12(4)10-13(14-5)11(2)3/h10-11H,6-9H2,1-5H3/b12-10+,14-13- |
| InChIKey | UNKQVJSYQGDODU-FJDRKQEFSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|