About 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline
2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline (PubChem CID 166994856) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline.
Molecular Properties
| Compound Name | 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline |
| PubChem CID | 166994856 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline |
| SMILES | C=CC(Nc1ccccc1C)/C(C)=C/C |
| InChI | InChI=1S/C14H19N/c1-5-11(3)13(6-2)15-14-10-8-7-9-12(14)4/h5-10,13,15H,2H2,1,3-4H3/b11-5+ |
| InChIKey | TUTXSTMPTZMTPZ-VZUCSPMQSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline?
The IUPAC name of 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline (CID 166994856) is 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline.
What is the SMILES notation for 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline?
The canonical SMILES for 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline is C=CC(Nc1ccccc1C)/C(C)=C/C.
What is the InChIKey of 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline?
The InChIKey is TUTXSTMPTZMTPZ-VZUCSPMQSA-N. The full InChI is InChI=1S/C14H19N/c1-5-11(3)13(6-2)15-14-10-8-7-9-12(14)4/h5-10,13,15H,2H2,1,3-4H3/b11-5+.
What are the key properties of 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline?
2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline has a molecular weight of 201.31 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(4E)-4-methylhexa-1,4-dien-3-yl]aniline is sourced from PubChem (CID 166994856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).