C26H27F3N4O2 — CID 166997504
3-[(4-aminophenyl)methyl-methylamino]-4-[1-[formyl(methyl)amino]ethyl]-N-[(2,4,6-trifluorophenyl)methyl]benzamide (PubChem CID 166997504) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methyl-methylamino]-4-[1-[formyl(methyl)amino]ethyl]-N-[(2,4,6-trifluorophenyl)methyl]benzamide.
| Compound Name | 3-[(4-aminophenyl)methyl-methylamino]-4-[1-[formyl(methyl)amino]ethyl]-N-[(2,4,6-trifluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 166997504 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-[(4-aminophenyl)methyl-methylamino]-4-[1-[formyl(methyl)amino]ethyl]-N-[(2,4,6-trifluorophenyl)methyl]benzamide |
| SMILES | CC(c1ccc(C(=O)NCc2c(F)cc(F)cc2F)cc1N(C)Cc1ccc(N)cc1)N(C)C=O |
| InChI | InChI=1S/C26H27F3N4O2/c1-16(33(3)15-34)21-9-6-18(10-25(21)32(2)14-17-4-7-20(30)8-5-17)26(35)31-13-22-23(28)11-19(27)12-24(22)29/h4-12,15-16H,13-14,30H2,1-3H3,(H,31,35) |
| InChIKey | OPHDFLDWCMTPRW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|