C17H18N2O2S — CID 166998235
1-isoquinolin-5-yloxy-3-(methylamino)-1-thiophen-2-ylpropan-1-ol (PubChem CID 166998235) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-isoquinolin-5-yloxy-3-(methylamino)-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 1-isoquinolin-5-yloxy-3-(methylamino)-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 166998235 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-isoquinolin-5-yloxy-3-(methylamino)-1-thiophen-2-ylpropan-1-ol |
| SMILES | CNCCC(O)(Oc1cccc2cnccc12)c1cccs1 |
| InChI | InChI=1S/C17H18N2O2S/c1-18-10-8-17(20,16-6-3-11-22-16)21-15-5-2-4-13-12-19-9-7-14(13)15/h2-7,9,11-12,18,20H,8,10H2,1H3 |
| InChIKey | HMCGGXUOKHOMAT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|