C19H18F3N3O — CID 135145309
3-isoquinolin-5-yloxy-N-methyl-3-[6-(trifluoromethyl)-3-pyridinyl]propan-1-amine (PubChem CID 135145309) has the molecular formula C19H18F3N3O and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-isoquinolin-5-yloxy-N-methyl-3-[6-(trifluoromethyl)-3-pyridinyl]propan-1-amine.
| Compound Name | 3-isoquinolin-5-yloxy-N-methyl-3-[6-(trifluoromethyl)-3-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 135145309 |
| Molecular Formula | C19H18F3N3O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-isoquinolin-5-yloxy-N-methyl-3-[6-(trifluoromethyl)-3-pyridinyl]propan-1-amine |
| SMILES | CNCCC(Oc1cccc2cnccc12)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C19H18F3N3O/c1-23-9-8-16(14-5-6-18(25-12-14)19(20,21)22)26-17-4-2-3-13-11-24-10-7-15(13)17/h2-7,10-12,16,23H,8-9H2,1H3 |
| InChIKey | RTLGODNTRJMDOX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |