C16H20N4 — CID 166999311
3-[2,3,4-tris(2-cyanoethyl)cyclobutyl]propanenitrile (PubChem CID 166999311) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[2,3,4-tris(2-cyanoethyl)cyclobutyl]propanenitrile.
| Compound Name | 3-[2,3,4-tris(2-cyanoethyl)cyclobutyl]propanenitrile |
|---|---|
| PubChem CID | 166999311 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-[2,3,4-tris(2-cyanoethyl)cyclobutyl]propanenitrile |
| SMILES | N#CCCC1C(CCC#N)C(CCC#N)C1CCC#N |
| InChI | InChI=1S/C16H20N4/c17-9-1-5-13-14(6-2-10-18)16(8-4-12-20)15(13)7-3-11-19/h13-16H,1-8H2 |
| InChIKey | INHDPFQNXYTFOJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |