C24H30N6 — CID 166999538
3-[2,3,4,5,6-pentakis(2-cyanoethyl)cyclohexyl]propanenitrile (PubChem CID 166999538) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 3-[2,3,4,5,6-pentakis(2-cyanoethyl)cyclohexyl]propanenitrile.
| Compound Name | 3-[2,3,4,5,6-pentakis(2-cyanoethyl)cyclohexyl]propanenitrile |
|---|---|
| PubChem CID | 166999538 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 3-[2,3,4,5,6-pentakis(2-cyanoethyl)cyclohexyl]propanenitrile |
| SMILES | N#CCCC1C(CCC#N)C(CCC#N)C(CCC#N)C(CCC#N)C1CCC#N |
| InChI | InChI=1S/C24H30N6/c25-13-1-7-19-20(8-2-14-26)22(10-4-16-28)24(12-6-18-30)23(11-5-17-29)21(19)9-3-15-27/h19-24H,1-12H2 |
| InChIKey | IKJSIIFYCYAEET-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |