C11H19NO — CID 167000951
2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxy-N-methylethanamine (PubChem CID 167000951) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxy-N-methylethanamine.
| Compound Name | 2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 167000951 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxy-N-methylethanamine |
| SMILES | CNCCOC1=C[C@@H](C)[C@@H](C)C=C1 |
| InChI | InChI=1S/C11H19NO/c1-9-4-5-11(8-10(9)2)13-7-6-12-3/h4-5,8-10,12H,6-7H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | JFCBYHMUGXRWJK-VHSXEESVSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|