C10H17NO — CID 123770200
N-methyl-2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethanamine (PubChem CID 123770200) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N-methyl-2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethanamine.
| Compound Name | N-methyl-2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethanamine |
|---|---|
| PubChem CID | 123770200 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-methyl-2-(5-methylcyclohexa-1,5-dien-1-yl)oxyethanamine |
| SMILES | CNCCOC1=CCCC(C)=C1 |
| InChI | InChI=1S/C10H17NO/c1-9-4-3-5-10(8-9)12-7-6-11-2/h5,8,11H,3-4,6-7H2,1-2H3 |
| InChIKey | ZLTJCKAQLJEXRV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|