C12H19NO — CID 142068009
2-(4-ethylcyclohepta-2,4,6-trien-1-yl)oxy-N-methylethanamine (PubChem CID 142068009) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(4-ethylcyclohepta-2,4,6-trien-1-yl)oxy-N-methylethanamine.
| Compound Name | 2-(4-ethylcyclohepta-2,4,6-trien-1-yl)oxy-N-methylethanamine |
|---|---|
| PubChem CID | 142068009 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(4-ethylcyclohepta-2,4,6-trien-1-yl)oxy-N-methylethanamine |
| SMILES | CCC1=CC=CC(OCCNC)C=C1 |
| InChI | InChI=1S/C12H19NO/c1-3-11-5-4-6-12(8-7-11)14-10-9-13-2/h4-8,12-13H,3,9-10H2,1-2H3 |
| InChIKey | VUUKKCBKCXHHIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|