C11H19NO — CID 88614288
3-[(2Z,4E)-3-methylhepta-2,4-dien-4-yl]oxyazetidine (PubChem CID 88614288) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-[(2Z,4E)-3-methylhepta-2,4-dien-4-yl]oxyazetidine.
| Compound Name | 3-[(2Z,4E)-3-methylhepta-2,4-dien-4-yl]oxyazetidine |
|---|---|
| PubChem CID | 88614288 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-[(2Z,4E)-3-methylhepta-2,4-dien-4-yl]oxyazetidine |
| SMILES | C/C=C(C)\C(=C/CC)OC1CNC1 |
| InChI | InChI=1S/C11H19NO/c1-4-6-11(9(3)5-2)13-10-7-12-8-10/h5-6,10,12H,4,7-8H2,1-3H3/b9-5-,11-6+ |
| InChIKey | PEVLWBDBTUASOS-YCQMDOFOSA-N |
| XLogP | 2.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|