C14H25NO — CID 143935670
ethane;N-ethyl-2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxyethanamine (PubChem CID 143935670) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;N-ethyl-2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxyethanamine.
| Compound Name | ethane;N-ethyl-2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxyethanamine |
|---|---|
| PubChem CID | 143935670 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;N-ethyl-2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxyethanamine |
| SMILES | CC.CCNCCOC1=CC=C(C)CC=C1 |
| InChI | InChI=1S/C12H19NO.C2H6/c1-3-13-9-10-14-12-6-4-5-11(2)7-8-12;1-2/h4,6-8,13H,3,5,9-10H2,1-2H3;1-2H3 |
| InChIKey | NCNRESRWZHMFLZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|