C17H31NO2 — CID 123211623
3-ethenyl-5-methoxy-N-(2-propoxybutyl)hepta-3,5-dien-2-amine (PubChem CID 123211623) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-ethenyl-5-methoxy-N-(2-propoxybutyl)hepta-3,5-dien-2-amine.
| Compound Name | 3-ethenyl-5-methoxy-N-(2-propoxybutyl)hepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 123211623 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 3-ethenyl-5-methoxy-N-(2-propoxybutyl)hepta-3,5-dien-2-amine |
| SMILES | C=CC(=CC(=CC)OC)C(C)NCC(CC)OCCC |
| InChI | InChI=1S/C17H31NO2/c1-7-11-20-17(10-4)13-18-14(5)15(8-2)12-16(9-3)19-6/h8-9,12,14,17-18H,2,7,10-11,13H2,1,3-6H3 |
| InChIKey | UNNVRECXCGHOTA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|