C30H45NO2 — CID 142834135
ethane;(E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine;prop-1-ene (PubChem CID 142834135) has the molecular formula C30H45NO2 and a molecular weight of 451.70 g/mol. Its IUPAC name is ethane;(E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine;prop-1-ene.
| Compound Name | ethane;(E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine;prop-1-ene |
|---|---|
| PubChem CID | 142834135 |
| Molecular Formula | C30H45NO2 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.35 |
| IUPAC Name | ethane;(E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine;prop-1-ene |
| SMILES | C#CCOC1=C(/C(C)=C/C=C(\C=C)OC)C=C(CN[C@H](C)/C(C)=C/C)CC=C1.C=CC.CC |
| InChI | InChI=1S/C25H33NO2.C3H6.C2H6/c1-8-16-28-25-13-11-12-22(18-26-21(6)19(4)9-2)17-24(25)20(5)14-15-23(10-3)27-7;1-3-2;1-2/h1,9-11,13-15,17,21,26H,3,12,16,18H2,2,4-7H3;3H,1H2,2H3;1-2H3/b19-9+,20-14+,23-15+;;/t21-;;/m1../s1 |
| InChIKey | FCVXQYUTFGZELS-PLCDYSCYSA-N |
| XLogP | 7.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|