C15H29NO — CID 142183657
ethane;(4E)-4-ethenyl-3-ethoxy-N-ethylhepta-4,6-dien-2-amine (PubChem CID 142183657) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is ethane;(4E)-4-ethenyl-3-ethoxy-N-ethylhepta-4,6-dien-2-amine.
| Compound Name | ethane;(4E)-4-ethenyl-3-ethoxy-N-ethylhepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 142183657 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | ethane;(4E)-4-ethenyl-3-ethoxy-N-ethylhepta-4,6-dien-2-amine |
| SMILES | C=C/C=C(\C=C)C(OCC)C(C)NCC.CC |
| InChI | InChI=1S/C13H23NO.C2H6/c1-6-10-12(7-2)13(15-9-4)11(5)14-8-3;1-2/h6-7,10-11,13-14H,1-2,8-9H2,3-5H3;1-2H3/b12-10+; |
| InChIKey | HKYOXWIREYGPRD-VHPXAQPISA-N |
| XLogP | 3.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|