C24H28N4O2S — CID 167002716
N-nitroso-1-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide (PubChem CID 167002716) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-nitroso-1-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide.
| Compound Name | N-nitroso-1-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167002716 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-nitroso-1-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]sulfanyl-3,6-dihydro-2H-pyridine-4-carboxamide |
| SMILES | O=NNC(=O)C1=CCN(Sc2ccc(-c3ccc(CN4CCCCC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H28N4O2S/c29-24(25-26-30)22-12-16-28(17-13-22)31-23-10-8-21(9-11-23)20-6-4-19(5-7-20)18-27-14-2-1-3-15-27/h4-12H,1-3,13-18H2,(H,25,29,30) |
| InChIKey | CUFUCUNIHDNCHA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|