C17H25FN2O3S2 — CID 167009188
4-[2-[(3-fluoro-3-methylsulfanylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine (PubChem CID 167009188) has the molecular formula C17H25FN2O3S2 and a molecular weight of 388.53 g/mol. Its IUPAC name is 4-[2-[(3-fluoro-3-methylsulfanylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[2-[(3-fluoro-3-methylsulfanylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 167009188 |
| Molecular Formula | C17H25FN2O3S2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-[2-[(3-fluoro-3-methylsulfanylpiperidin-1-yl)methyl]phenyl]sulfonylmorpholine |
| SMILES | CSC1(F)CCCN(Cc2ccccc2S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C17H25FN2O3S2/c1-24-17(18)7-4-8-19(14-17)13-15-5-2-3-6-16(15)25(21,22)20-9-11-23-12-10-20/h2-3,5-6H,4,7-14H2,1H3 |
| InChIKey | AVWRYICLCUHFCJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |