C7H5I2N3 — CID 167010033
3,6-diiodo-2-methylimidazo[4,5-b]pyridine (PubChem CID 167010033) has the molecular formula C7H5I2N3 and a molecular weight of 384.95 g/mol. Its IUPAC name is 3,6-diiodo-2-methylimidazo[4,5-b]pyridine.
| Compound Name | 3,6-diiodo-2-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 167010033 |
| Molecular Formula | C7H5I2N3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.86 |
| IUPAC Name | 3,6-diiodo-2-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1nc2cc(I)cnc2n1I |
| InChI | InChI=1S/C7H5I2N3/c1-4-11-6-2-5(8)3-10-7(6)12(4)9/h2-3H,1H3 |
| InChIKey | AQCZYARADIVROS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|