About 3,6-diiodo-2-methylimidazo[4,5-b]pyridine
3,6-diiodo-2-methylimidazo[4,5-b]pyridine (PubChem CID 167010033) has the molecular formula C7H5I2N3
and a molecular weight of 384.95 g/mol. Its IUPAC name is 3,6-diiodo-2-methylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3,6-diiodo-2-methylimidazo[4,5-b]pyridine |
| PubChem CID | 167010033 |
| Molecular Formula | C7H5I2N3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.86 |
| IUPAC Name | 3,6-diiodo-2-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1nc2cc(I)cnc2n1I |
| InChI | InChI=1S/C7H5I2N3/c1-4-11-6-2-5(8)3-10-7(6)12(4)9/h2-3H,1H3 |
| InChIKey | AQCZYARADIVROS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diiodo-2-methylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diiodo-2-methylimidazo[4,5-b]pyridine?
The IUPAC name of 3,6-diiodo-2-methylimidazo[4,5-b]pyridine (CID 167010033) is 3,6-diiodo-2-methylimidazo[4,5-b]pyridine.
What is the SMILES notation for 3,6-diiodo-2-methylimidazo[4,5-b]pyridine?
The canonical SMILES for 3,6-diiodo-2-methylimidazo[4,5-b]pyridine is Cc1nc2cc(I)cnc2n1I.
What is the InChIKey of 3,6-diiodo-2-methylimidazo[4,5-b]pyridine?
The InChIKey is AQCZYARADIVROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5I2N3/c1-4-11-6-2-5(8)3-10-7(6)12(4)9/h2-3H,1H3.
What are the key properties of 3,6-diiodo-2-methylimidazo[4,5-b]pyridine?
3,6-diiodo-2-methylimidazo[4,5-b]pyridine has a molecular weight of 384.95 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diiodo-2-methylimidazo[4,5-b]pyridine is sourced from PubChem (CID 167010033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).