C19H18F2N4O5 — CID 167013504
(3S)-N-[(3,5-difluoro-4-pyridinyl)methyl]-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 167013504) has the molecular formula C19H18F2N4O5 and a molecular weight of 420.37 g/mol. Its IUPAC name is (3S)-N-[(3,5-difluoro-4-pyridinyl)methyl]-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (3S)-N-[(3,5-difluoro-4-pyridinyl)methyl]-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 167013504 |
| Molecular Formula | C19H18F2N4O5 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (3S)-N-[(3,5-difluoro-4-pyridinyl)methyl]-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CC1CCO[C@H]2Cn3cc(C(=O)NCc4c(F)cncc4F)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C19H18F2N4O5/c1-9-2-3-30-14-8-24-7-11(16(26)17(27)15(24)19(29)25(9)14)18(28)23-4-10-12(20)5-22-6-13(10)21/h5-7,9,14,27H,2-4,8H2,1H3,(H,23,28)/t9?,14-/m0/s1 |
| InChIKey | RQZCFUQGVGPUBP-RJSPSEDBSA-N |
| XLogP | 0.75 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |