C20H22N4O — CID 167014311
4-[(4-methyl-7-prop-1-ynyl-2-tricyclo[3.3.0.03,7]octanyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 167014311) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[(4-methyl-7-prop-1-ynyl-2-tricyclo[3.3.0.03,7]octanyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 4-[(4-methyl-7-prop-1-ynyl-2-tricyclo[3.3.0.03,7]octanyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 167014311 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-[(4-methyl-7-prop-1-ynyl-2-tricyclo[3.3.0.03,7]octanyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | CC#CC12CC3C(C)C1C(Nc1c(C(N)=O)cnc4[nH]ccc14)C3C2 |
| InChI | InChI=1S/C20H22N4O/c1-3-5-20-7-12-10(2)15(20)17(13(12)8-20)24-16-11-4-6-22-19(11)23-9-14(16)18(21)25/h4,6,9-10,12-13,15,17H,7-8H2,1-2H3,(H2,21,25)(H2,22,23,24) |
| InChIKey | ARYJIOUJZPCEPZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|