C12H20S — CID 167017357
(4S)-6,11-dimethyl-9-thiatricyclo[6.2.1.04,10]undecane (PubChem CID 167017357) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is (4S)-6,11-dimethyl-9-thiatricyclo[6.2.1.04,10]undecane.
| Compound Name | (4S)-6,11-dimethyl-9-thiatricyclo[6.2.1.04,10]undecane |
|---|---|
| PubChem CID | 167017357 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (4S)-6,11-dimethyl-9-thiatricyclo[6.2.1.04,10]undecane |
| SMILES | CC1CC2SC3C(CC[C@H]3C1)C2C |
| InChI | InChI=1S/C12H20S/c1-7-5-9-3-4-10-8(2)11(6-7)13-12(9)10/h7-12H,3-6H2,1-2H3/t7?,8?,9-,10?,11?,12?/m0/s1 |
| InChIKey | ZWHDXWJXVIFREO-GISRUYEVSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |