C24H20N2O3S — CID 167018347
6-(azetidin-1-yl)-N-(2-phenylphenyl)sulfinyl-1-benzofuran-2-carboxamide (PubChem CID 167018347) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is 6-(azetidin-1-yl)-N-(2-phenylphenyl)sulfinyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-(azetidin-1-yl)-N-(2-phenylphenyl)sulfinyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167018347 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 6-(azetidin-1-yl)-N-(2-phenylphenyl)sulfinyl-1-benzofuran-2-carboxamide |
| SMILES | O=C(NS(=O)c1ccccc1-c1ccccc1)c1cc2ccc(N3CCC3)cc2o1 |
| InChI | InChI=1S/C24H20N2O3S/c27-24(22-15-18-11-12-19(16-21(18)29-22)26-13-6-14-26)25-30(28)23-10-5-4-9-20(23)17-7-2-1-3-8-17/h1-5,7-12,15-16H,6,13-14H2,(H,25,27) |
| InChIKey | AUXRTXFAHINLIG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |