C23H24FN3O5S — CID 167018574
6-(azetidin-1-yl)-4-fluoro-N-(2-methoxy-5-morpholin-4-ylphenyl)sulfinyl-1-benzofuran-2-carboxamide (PubChem CID 167018574) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is 6-(azetidin-1-yl)-4-fluoro-N-(2-methoxy-5-morpholin-4-ylphenyl)sulfinyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-(azetidin-1-yl)-4-fluoro-N-(2-methoxy-5-morpholin-4-ylphenyl)sulfinyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167018574 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 6-(azetidin-1-yl)-4-fluoro-N-(2-methoxy-5-morpholin-4-ylphenyl)sulfinyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)cc1S(=O)NC(=O)c1cc2c(F)cc(N3CCC3)cc2o1 |
| InChI | InChI=1S/C23H24FN3O5S/c1-30-19-4-3-15(27-7-9-31-10-8-27)13-22(19)33(29)25-23(28)21-14-17-18(24)11-16(12-20(17)32-21)26-5-2-6-26/h3-4,11-14H,2,5-10H2,1H3,(H,25,28) |
| InChIKey | SBTMRKJEFMZONX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|