C26H23FN2O4S — CID 167018583
6-(azetidin-1-yl)-N-(2-ethoxy-5-phenoxyphenyl)sulfanyl-4-fluoro-1-benzofuran-2-carboxamide (PubChem CID 167018583) has the molecular formula C26H23FN2O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is 6-(azetidin-1-yl)-N-(2-ethoxy-5-phenoxyphenyl)sulfanyl-4-fluoro-1-benzofuran-2-carboxamide.
| Compound Name | 6-(azetidin-1-yl)-N-(2-ethoxy-5-phenoxyphenyl)sulfanyl-4-fluoro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167018583 |
| Molecular Formula | C26H23FN2O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 6-(azetidin-1-yl)-N-(2-ethoxy-5-phenoxyphenyl)sulfanyl-4-fluoro-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc(Oc2ccccc2)cc1SNC(=O)c1cc2c(F)cc(N3CCC3)cc2o1 |
| InChI | InChI=1S/C26H23FN2O4S/c1-2-31-22-10-9-19(32-18-7-4-3-5-8-18)15-25(22)34-28-26(30)24-16-20-21(27)13-17(14-23(20)33-24)29-11-6-12-29/h3-5,7-10,13-16H,2,6,11-12H2,1H3,(H,28,30) |
| InChIKey | WNKQEHDXPKWGKT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|