C26H23FN2O2S — CID 167018646
6-(2,2-dimethylazetidin-1-yl)-4-fluoro-N-(2-phenylphenyl)sulfanyl-1-benzofuran-2-carboxamide (PubChem CID 167018646) has the molecular formula C26H23FN2O2S and a molecular weight of 446.55 g/mol. Its IUPAC name is 6-(2,2-dimethylazetidin-1-yl)-4-fluoro-N-(2-phenylphenyl)sulfanyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-(2,2-dimethylazetidin-1-yl)-4-fluoro-N-(2-phenylphenyl)sulfanyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167018646 |
| Molecular Formula | C26H23FN2O2S |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 6-(2,2-dimethylazetidin-1-yl)-4-fluoro-N-(2-phenylphenyl)sulfanyl-1-benzofuran-2-carboxamide |
| SMILES | CC1(C)CCN1c1cc(F)c2cc(C(=O)NSc3ccccc3-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C26H23FN2O2S/c1-26(2)12-13-29(26)18-14-21(27)20-16-23(31-22(20)15-18)25(30)28-32-24-11-7-6-10-19(24)17-8-4-3-5-9-17/h3-11,14-16H,12-13H2,1-2H3,(H,28,30) |
| InChIKey | USCLKDVDBNITGC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|