C20H19FN4O3S — CID 167018634
2-[[6-(azetidin-1-yl)-4-fluoro-1-benzofuran-2-carbonyl]amino]sulfanyl-N,N-dimethylpyridine-3-carboxamide (PubChem CID 167018634) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[[6-(azetidin-1-yl)-4-fluoro-1-benzofuran-2-carbonyl]amino]sulfanyl-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-[[6-(azetidin-1-yl)-4-fluoro-1-benzofuran-2-carbonyl]amino]sulfanyl-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 167018634 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[[6-(azetidin-1-yl)-4-fluoro-1-benzofuran-2-carbonyl]amino]sulfanyl-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccnc1SNC(=O)c1cc2c(F)cc(N3CCC3)cc2o1 |
| InChI | InChI=1S/C20H19FN4O3S/c1-24(2)20(27)13-5-3-6-22-19(13)29-23-18(26)17-11-14-15(21)9-12(10-16(14)28-17)25-7-4-8-25/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,23,26) |
| InChIKey | LLPIVTVICWBABC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|