C22H16BrNO4S — CID 155234394
6-bromo-4-methyl-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide (PubChem CID 155234394) has the molecular formula C22H16BrNO4S and a molecular weight of 470.34 g/mol. Its IUPAC name is 6-bromo-4-methyl-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-bromo-4-methyl-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155234394 |
| Molecular Formula | C22H16BrNO4S |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 6-bromo-4-methyl-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(Br)cc2oc(C(=O)NS(=O)(=O)c3ccccc3-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H16BrNO4S/c1-14-11-16(23)12-19-18(14)13-20(28-19)22(25)24-29(26,27)21-10-6-5-9-17(21)15-7-3-2-4-8-15/h2-13H,1H3,(H,24,25) |
| InChIKey | LZHFVJMYXRBVHS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |