C18H15BrFNO5S — CID 155234510
6-bromo-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide (PubChem CID 155234510) has the molecular formula C18H15BrFNO5S and a molecular weight of 456.29 g/mol. Its IUPAC name is 6-bromo-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-bromo-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155234510 |
| Molecular Formula | C18H15BrFNO5S |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | 6-bromo-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide |
| SMILES | CCCOc1ccccc1S(=O)(=O)NC(=O)c1cc2c(F)cc(Br)cc2o1 |
| InChI | InChI=1S/C18H15BrFNO5S/c1-2-7-25-14-5-3-4-6-17(14)27(23,24)21-18(22)16-10-12-13(20)8-11(19)9-15(12)26-16/h3-6,8-10H,2,7H2,1H3,(H,21,22) |
| InChIKey | WFZZHLQKMVDCLE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |