C21H20FNO5S — CID 166596093
6-cyclopropyl-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide (PubChem CID 166596093) has the molecular formula C21H20FNO5S and a molecular weight of 417.46 g/mol. Its IUPAC name is 6-cyclopropyl-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-cyclopropyl-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 166596093 |
| Molecular Formula | C21H20FNO5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 6-cyclopropyl-4-fluoro-N-(2-propoxyphenyl)sulfonyl-1-benzofuran-2-carboxamide |
| SMILES | CCCOc1ccccc1S(=O)(=O)NC(=O)c1cc2c(F)cc(C3CC3)cc2o1 |
| InChI | InChI=1S/C21H20FNO5S/c1-2-9-27-17-5-3-4-6-20(17)29(25,26)23-21(24)19-12-15-16(22)10-14(13-7-8-13)11-18(15)28-19/h3-6,10-13H,2,7-9H2,1H3,(H,23,24) |
| InChIKey | ODHGVNVCLITLAK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |